C12H22N2S — CID 104681857
N,2-dimethyl-N-(thiophen-2-ylmethyl)pentane-1,5-diamine (PubChem CID 104681857) has the molecular formula C12H22N2S and a molecular weight of 226.39 g/mol. Its IUPAC name is N,2-dimethyl-N-(thiophen-2-ylmethyl)pentane-1,5-diamine.
| Compound Name | N,2-dimethyl-N-(thiophen-2-ylmethyl)pentane-1,5-diamine |
|---|---|
| PubChem CID | 104681857 |
| Molecular Formula | C12H22N2S |
| Molecular Weight | 226.39 g/mol |
| Exact Mass | 226.15 |
| IUPAC Name | N,2-dimethyl-N-(thiophen-2-ylmethyl)pentane-1,5-diamine |
| SMILES | CC(CCCN)CN(C)Cc1cccs1 |
| InChI | InChI=1S/C12H22N2S/c1-11(5-3-7-13)9-14(2)10-12-6-4-8-15-12/h4,6,8,11H,3,5,7,9-10,13H2,1-2H3 |
| InChIKey | NKDVFFGVMNIORN-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.39 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |