About 5-ethyl-5-[(4-methyl-1,3-thiazol-5-yl)methyl]pyrrolidin-2-one
5-ethyl-5-[(4-methyl-1,3-thiazol-5-yl)methyl]pyrrolidin-2-one (PubChem CID 104687460) has the molecular formula C11H16N2OS
and a molecular weight of 224.33 g/mol. Its IUPAC name is 5-ethyl-5-[(4-methyl-1,3-thiazol-5-yl)methyl]pyrrolidin-2-one.
Molecular Properties
| Compound Name | 5-ethyl-5-[(4-methyl-1,3-thiazol-5-yl)methyl]pyrrolidin-2-one |
| PubChem CID | 104687460 |
| Molecular Formula | C11H16N2OS |
| Molecular Weight | 224.33 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 5-ethyl-5-[(4-methyl-1,3-thiazol-5-yl)methyl]pyrrolidin-2-one |
| SMILES | CCC1(Cc2scnc2C)CCC(=O)N1 |
| InChI | InChI=1S/C11H16N2OS/c1-3-11(5-4-10(14)13-11)6-9-8(2)12-7-15-9/h7H,3-6H2,1-2H3,(H,13,14) |
| InChIKey | DJEWCURURUFPAS-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.33 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-ethyl-5-[(4-methyl-1,3-thiazol-5-yl)methyl]pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-5-[(4-methyl-1,3-thiazol-5-yl)methyl]pyrrolidin-2-one?
The IUPAC name of 5-ethyl-5-[(4-methyl-1,3-thiazol-5-yl)methyl]pyrrolidin-2-one (CID 104687460) is 5-ethyl-5-[(4-methyl-1,3-thiazol-5-yl)methyl]pyrrolidin-2-one.
What is the SMILES notation for 5-ethyl-5-[(4-methyl-1,3-thiazol-5-yl)methyl]pyrrolidin-2-one?
The canonical SMILES for 5-ethyl-5-[(4-methyl-1,3-thiazol-5-yl)methyl]pyrrolidin-2-one is CCC1(Cc2scnc2C)CCC(=O)N1.
What is the InChIKey of 5-ethyl-5-[(4-methyl-1,3-thiazol-5-yl)methyl]pyrrolidin-2-one?
The InChIKey is DJEWCURURUFPAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2OS/c1-3-11(5-4-10(14)13-11)6-9-8(2)12-7-15-9/h7H,3-6H2,1-2H3,(H,13,14).
What are the key properties of 5-ethyl-5-[(4-methyl-1,3-thiazol-5-yl)methyl]pyrrolidin-2-one?
5-ethyl-5-[(4-methyl-1,3-thiazol-5-yl)methyl]pyrrolidin-2-one has a molecular weight of 224.33 g/mol, XLogP of 2.05, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-5-[(4-methyl-1,3-thiazol-5-yl)methyl]pyrrolidin-2-one is sourced from PubChem (CID 104687460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).