C11H14ClNOS — CID 104687431
5-[(4-chlorothiophen-2-yl)methyl]-5-ethylpyrrolidin-2-one (PubChem CID 104687431) has the molecular formula C11H14ClNOS and a molecular weight of 243.76 g/mol. Its IUPAC name is 5-[(4-chlorothiophen-2-yl)methyl]-5-ethylpyrrolidin-2-one.
| Compound Name | 5-[(4-chlorothiophen-2-yl)methyl]-5-ethylpyrrolidin-2-one |
|---|---|
| PubChem CID | 104687431 |
| Molecular Formula | C11H14ClNOS |
| Molecular Weight | 243.76 g/mol |
| Exact Mass | 243.05 |
| IUPAC Name | 5-[(4-chlorothiophen-2-yl)methyl]-5-ethylpyrrolidin-2-one |
| SMILES | CCC1(Cc2cc(Cl)cs2)CCC(=O)N1 |
| InChI | InChI=1S/C11H14ClNOS/c1-2-11(4-3-10(14)13-11)6-9-5-8(12)7-15-9/h5,7H,2-4,6H2,1H3,(H,13,14) |
| InChIKey | NJGMSAHNRUHKDI-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.76 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |