C17H26OS — CID 10468795
2-thiophen-2-yl-4-(2,6,6-trimethylcyclohexen-1-yl)butan-2-ol (PubChem CID 10468795) has the molecular formula C17H26OS and a molecular weight of 278.46 g/mol. Its IUPAC name is 2-thiophen-2-yl-4-(2,6,6-trimethylcyclohexen-1-yl)butan-2-ol.
| Compound Name | 2-thiophen-2-yl-4-(2,6,6-trimethylcyclohexen-1-yl)butan-2-ol |
|---|---|
| PubChem CID | 10468795 |
| Molecular Formula | C17H26OS |
| Molecular Weight | 278.46 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | 2-thiophen-2-yl-4-(2,6,6-trimethylcyclohexen-1-yl)butan-2-ol |
| SMILES | CC1=C(CCC(C)(O)c2cccs2)C(C)(C)CCC1 |
| InChI | InChI=1S/C17H26OS/c1-13-7-5-10-16(2,3)14(13)9-11-17(4,18)15-8-6-12-19-15/h6,8,12,18H,5,7,9-11H2,1-4H3 |
| InChIKey | ILKGETIXDAHPOO-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.46 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|