C11H16N4O — CID 104693712
2-cyano-2-methyl-N-[2-(2-methylpyrazol-3-yl)ethyl]propanamide (PubChem CID 104693712) has the molecular formula C11H16N4O and a molecular weight of 220.28 g/mol. Its IUPAC name is 2-cyano-2-methyl-N-[2-(2-methylpyrazol-3-yl)ethyl]propanamide.
| Compound Name | 2-cyano-2-methyl-N-[2-(2-methylpyrazol-3-yl)ethyl]propanamide |
|---|---|
| PubChem CID | 104693712 |
| Molecular Formula | C11H16N4O |
| Molecular Weight | 220.28 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | 2-cyano-2-methyl-N-[2-(2-methylpyrazol-3-yl)ethyl]propanamide |
| SMILES | Cn1nccc1CCNC(=O)C(C)(C)C#N |
| InChI | InChI=1S/C11H16N4O/c1-11(2,8-12)10(16)13-6-4-9-5-7-14-15(9)3/h5,7H,4,6H2,1-3H3,(H,13,16) |
| InChIKey | FIXDTUMBWQHKOZ-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 70.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.28 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |