C14H16F2N2O3 — CID 104699476
N-tert-butyl-2,5-difluoro-4-nitro-N-prop-2-enylbenzamide (PubChem CID 104699476) has the molecular formula C14H16F2N2O3 and a molecular weight of 298.29 g/mol. Its IUPAC name is N-tert-butyl-2,5-difluoro-4-nitro-N-prop-2-enylbenzamide.
| Compound Name | N-tert-butyl-2,5-difluoro-4-nitro-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 104699476 |
| Molecular Formula | C14H16F2N2O3 |
| Molecular Weight | 298.29 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | N-tert-butyl-2,5-difluoro-4-nitro-N-prop-2-enylbenzamide |
| SMILES | C=CCN(C(=O)c1cc(F)c([N+](=O)[O-])cc1F)C(C)(C)C |
| InChI | InChI=1S/C14H16F2N2O3/c1-5-6-17(14(2,3)4)13(19)9-7-11(16)12(18(20)21)8-10(9)15/h5,7-8H,1,6H2,2-4H3 |
| InChIKey | COPXMOAICOQGEF-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.29 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|