C9H13ClF3NO2 — CID 104701561
N-(1-chloro-3-ethyl-2-oxopentan-3-yl)-2,2,2-trifluoroacetamide (PubChem CID 104701561) has the molecular formula C9H13ClF3NO2 and a molecular weight of 259.65 g/mol. Its IUPAC name is N-(1-chloro-3-ethyl-2-oxopentan-3-yl)-2,2,2-trifluoroacetamide.
| Compound Name | N-(1-chloro-3-ethyl-2-oxopentan-3-yl)-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 104701561 |
| Molecular Formula | C9H13ClF3NO2 |
| Molecular Weight | 259.65 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | N-(1-chloro-3-ethyl-2-oxopentan-3-yl)-2,2,2-trifluoroacetamide |
| SMILES | CCC(CC)(NC(=O)C(F)(F)F)C(=O)CCl |
| InChI | InChI=1S/C9H13ClF3NO2/c1-3-8(4-2,6(15)5-10)14-7(16)9(11,12)13/h3-5H2,1-2H3,(H,14,16) |
| InChIKey | VDSMMUZPOBGFEV-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.65 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|