C6H10Br2O2S — CID 10470387
(2S,5R)-5-bromo-2-(bromomethyl)thiane 1,1-dioxide (PubChem CID 10470387) has the molecular formula C6H10Br2O2S and a molecular weight of 306.02 g/mol. Its IUPAC name is (2S,5R)-5-bromo-2-(bromomethyl)thiane 1,1-dioxide.
| Compound Name | (2S,5R)-5-bromo-2-(bromomethyl)thiane 1,1-dioxide |
|---|---|
| PubChem CID | 10470387 |
| Molecular Formula | C6H10Br2O2S |
| Molecular Weight | 306.02 g/mol |
| Exact Mass | 303.88 |
| IUPAC Name | (2S,5R)-5-bromo-2-(bromomethyl)thiane 1,1-dioxide |
| SMILES | O=S1(=O)C[C@H](Br)CC[C@H]1CBr |
| InChI | InChI=1S/C6H10Br2O2S/c7-3-6-2-1-5(8)4-11(6,9)10/h5-6H,1-4H2/t5-,6+/m1/s1 |
| InChIKey | LBJUIKRDZZTWFF-RITPCOANSA-N |
| XLogP | 1.72 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.02 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|