C11H17F2N3O2 — CID 104704912
1-[1-(difluoromethyl)imidazol-2-yl]-N-[(3-methoxyoxolan-3-yl)methyl]methanamine (PubChem CID 104704912) has the molecular formula C11H17F2N3O2 and a molecular weight of 261.27 g/mol. Its IUPAC name is 1-[1-(difluoromethyl)imidazol-2-yl]-N-[(3-methoxyoxolan-3-yl)methyl]methanamine.
| Compound Name | 1-[1-(difluoromethyl)imidazol-2-yl]-N-[(3-methoxyoxolan-3-yl)methyl]methanamine |
|---|---|
| PubChem CID | 104704912 |
| Molecular Formula | C11H17F2N3O2 |
| Molecular Weight | 261.27 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | 1-[1-(difluoromethyl)imidazol-2-yl]-N-[(3-methoxyoxolan-3-yl)methyl]methanamine |
| SMILES | COC1(CNCc2nccn2C(F)F)CCOC1 |
| InChI | InChI=1S/C11H17F2N3O2/c1-17-11(2-5-18-8-11)7-14-6-9-15-3-4-16(9)10(12)13/h3-4,10,14H,2,5-8H2,1H3 |
| InChIKey | WIBXKCWGTGZYPU-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 48.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.27 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |