C11H17F2N3 — CID 61364614
N-[[1-(difluoromethyl)imidazol-2-yl]methyl]-1-methylcyclopentan-1-amine (PubChem CID 61364614) has the molecular formula C11H17F2N3 and a molecular weight of 229.27 g/mol. Its IUPAC name is N-[[1-(difluoromethyl)imidazol-2-yl]methyl]-1-methylcyclopentan-1-amine.
| Compound Name | N-[[1-(difluoromethyl)imidazol-2-yl]methyl]-1-methylcyclopentan-1-amine |
|---|---|
| PubChem CID | 61364614 |
| Molecular Formula | C11H17F2N3 |
| Molecular Weight | 229.27 g/mol |
| Exact Mass | 229.14 |
| IUPAC Name | N-[[1-(difluoromethyl)imidazol-2-yl]methyl]-1-methylcyclopentan-1-amine |
| SMILES | CC1(NCc2nccn2C(F)F)CCCC1 |
| InChI | InChI=1S/C11H17F2N3/c1-11(4-2-3-5-11)15-8-9-14-6-7-16(9)10(12)13/h6-7,10,15H,2-5,8H2,1H3 |
| InChIKey | GQAFKCAZIRFXIF-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.27 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |