C10H17F2N3S — CID 115660800
N-[[1-(difluoromethyl)imidazol-2-yl]methyl]-1-ethylsulfanylpropan-2-amine (PubChem CID 115660800) has the molecular formula C10H17F2N3S and a molecular weight of 249.33 g/mol. Its IUPAC name is N-[[1-(difluoromethyl)imidazol-2-yl]methyl]-1-ethylsulfanylpropan-2-amine.
| Compound Name | N-[[1-(difluoromethyl)imidazol-2-yl]methyl]-1-ethylsulfanylpropan-2-amine |
|---|---|
| PubChem CID | 115660800 |
| Molecular Formula | C10H17F2N3S |
| Molecular Weight | 249.33 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | N-[[1-(difluoromethyl)imidazol-2-yl]methyl]-1-ethylsulfanylpropan-2-amine |
| SMILES | CCSCC(C)NCc1nccn1C(F)F |
| InChI | InChI=1S/C10H17F2N3S/c1-3-16-7-8(2)14-6-9-13-4-5-15(9)10(11)12/h4-5,8,10,14H,3,6-7H2,1-2H3 |
| InChIKey | JYRQCDZDNLLTBD-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.33 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |