C12H21F2N3 — CID 63837939
N-[[1-(difluoromethyl)imidazol-2-yl]methyl]-3-ethylpentan-2-amine (PubChem CID 63837939) has the molecular formula C12H21F2N3 and a molecular weight of 245.32 g/mol. Its IUPAC name is N-[[1-(difluoromethyl)imidazol-2-yl]methyl]-3-ethylpentan-2-amine.
| Compound Name | N-[[1-(difluoromethyl)imidazol-2-yl]methyl]-3-ethylpentan-2-amine |
|---|---|
| PubChem CID | 63837939 |
| Molecular Formula | C12H21F2N3 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.17 |
| IUPAC Name | N-[[1-(difluoromethyl)imidazol-2-yl]methyl]-3-ethylpentan-2-amine |
| SMILES | CCC(CC)C(C)NCc1nccn1C(F)F |
| InChI | InChI=1S/C12H21F2N3/c1-4-10(5-2)9(3)16-8-11-15-6-7-17(11)12(13)14/h6-7,9-10,12,16H,4-5,8H2,1-3H3 |
| InChIKey | FJQCDMNLBLEXHV-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |