C14H23F2N3 — CID 81391865
(1S)-1-cycloheptyl-N-[[1-(difluoromethyl)imidazol-2-yl]methyl]ethanamine (PubChem CID 81391865) has the molecular formula C14H23F2N3 and a molecular weight of 271.35 g/mol. Its IUPAC name is (1S)-1-cycloheptyl-N-[[1-(difluoromethyl)imidazol-2-yl]methyl]ethanamine.
| Compound Name | (1S)-1-cycloheptyl-N-[[1-(difluoromethyl)imidazol-2-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 81391865 |
| Molecular Formula | C14H23F2N3 |
| Molecular Weight | 271.35 g/mol |
| Exact Mass | 271.19 |
| IUPAC Name | (1S)-1-cycloheptyl-N-[[1-(difluoromethyl)imidazol-2-yl]methyl]ethanamine |
| SMILES | C[C@H](NCc1nccn1C(F)F)C1CCCCCC1 |
| InChI | InChI=1S/C14H23F2N3/c1-11(12-6-4-2-3-5-7-12)18-10-13-17-8-9-19(13)14(15)16/h8-9,11-12,14,18H,2-7,10H2,1H3/t11-/m0/s1 |
| InChIKey | JPBPJICKJQENIJ-NSHDSACASA-N |
| XLogP | 3.73 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.35 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |