C10H17F2N3O — CID 115714090
N-[[1-(difluoromethyl)imidazol-2-yl]methyl]-3-methoxybutan-2-amine (PubChem CID 115714090) has the molecular formula C10H17F2N3O and a molecular weight of 233.26 g/mol. Its IUPAC name is N-[[1-(difluoromethyl)imidazol-2-yl]methyl]-3-methoxybutan-2-amine.
| Compound Name | N-[[1-(difluoromethyl)imidazol-2-yl]methyl]-3-methoxybutan-2-amine |
|---|---|
| PubChem CID | 115714090 |
| Molecular Formula | C10H17F2N3O |
| Molecular Weight | 233.26 g/mol |
| Exact Mass | 233.13 |
| IUPAC Name | N-[[1-(difluoromethyl)imidazol-2-yl]methyl]-3-methoxybutan-2-amine |
| SMILES | COC(C)C(C)NCc1nccn1C(F)F |
| InChI | InChI=1S/C10H17F2N3O/c1-7(8(2)16-3)14-6-9-13-4-5-15(9)10(11)12/h4-5,7-8,10,14H,6H2,1-3H3 |
| InChIKey | FOXDZIPLORWUMZ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.26 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |