C11H19F2N3 — CID 115641650
N-[[1-(difluoromethyl)imidazol-2-yl]methyl]-2-ethylbutan-1-amine (PubChem CID 115641650) has the molecular formula C11H19F2N3 and a molecular weight of 231.29 g/mol. Its IUPAC name is N-[[1-(difluoromethyl)imidazol-2-yl]methyl]-2-ethylbutan-1-amine.
| Compound Name | N-[[1-(difluoromethyl)imidazol-2-yl]methyl]-2-ethylbutan-1-amine |
|---|---|
| PubChem CID | 115641650 |
| Molecular Formula | C11H19F2N3 |
| Molecular Weight | 231.29 g/mol |
| Exact Mass | 231.15 |
| IUPAC Name | N-[[1-(difluoromethyl)imidazol-2-yl]methyl]-2-ethylbutan-1-amine |
| SMILES | CCC(CC)CNCc1nccn1C(F)F |
| InChI | InChI=1S/C11H19F2N3/c1-3-9(4-2)7-14-8-10-15-5-6-16(10)11(12)13/h5-6,9,11,14H,3-4,7-8H2,1-2H3 |
| InChIKey | MXYQWHCQDAKEJG-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.29 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |