C8H13F2N3OS — CID 115641707
N-[[1-(difluoromethyl)imidazol-2-yl]methyl]-2-methylsulfinylethanamine (PubChem CID 115641707) has the molecular formula C8H13F2N3OS and a molecular weight of 237.27 g/mol. Its IUPAC name is N-[[1-(difluoromethyl)imidazol-2-yl]methyl]-2-methylsulfinylethanamine.
| Compound Name | N-[[1-(difluoromethyl)imidazol-2-yl]methyl]-2-methylsulfinylethanamine |
|---|---|
| PubChem CID | 115641707 |
| Molecular Formula | C8H13F2N3OS |
| Molecular Weight | 237.27 g/mol |
| Exact Mass | 237.07 |
| IUPAC Name | N-[[1-(difluoromethyl)imidazol-2-yl]methyl]-2-methylsulfinylethanamine |
| SMILES | CS(=O)CCNCc1nccn1C(F)F |
| InChI | InChI=1S/C8H13F2N3OS/c1-15(14)5-3-11-6-7-12-2-4-13(7)8(9)10/h2,4,8,11H,3,5-6H2,1H3 |
| InChIKey | CSAYHBXIRGKHHY-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.27 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|