C9H15F2N3S — CID 63966469
N-[[1-(difluoromethyl)imidazol-2-yl]methyl]-3-methylsulfanylpropan-1-amine (PubChem CID 63966469) has the molecular formula C9H15F2N3S and a molecular weight of 235.30 g/mol. Its IUPAC name is N-[[1-(difluoromethyl)imidazol-2-yl]methyl]-3-methylsulfanylpropan-1-amine.
| Compound Name | N-[[1-(difluoromethyl)imidazol-2-yl]methyl]-3-methylsulfanylpropan-1-amine |
|---|---|
| PubChem CID | 63966469 |
| Molecular Formula | C9H15F2N3S |
| Molecular Weight | 235.30 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | N-[[1-(difluoromethyl)imidazol-2-yl]methyl]-3-methylsulfanylpropan-1-amine |
| SMILES | CSCCCNCc1nccn1C(F)F |
| InChI | InChI=1S/C9H15F2N3S/c1-15-6-2-3-12-7-8-13-4-5-14(8)9(10)11/h4-5,9,12H,2-3,6-7H2,1H3 |
| InChIKey | DIQXGNZJMOOWGM-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.30 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|