C11H17F2N3 — CID 115690184
2-cyclobutyl-N-[[1-(difluoromethyl)imidazol-2-yl]methyl]ethanamine (PubChem CID 115690184) has the molecular formula C11H17F2N3 and a molecular weight of 229.27 g/mol. Its IUPAC name is 2-cyclobutyl-N-[[1-(difluoromethyl)imidazol-2-yl]methyl]ethanamine.
| Compound Name | 2-cyclobutyl-N-[[1-(difluoromethyl)imidazol-2-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 115690184 |
| Molecular Formula | C11H17F2N3 |
| Molecular Weight | 229.27 g/mol |
| Exact Mass | 229.14 |
| IUPAC Name | 2-cyclobutyl-N-[[1-(difluoromethyl)imidazol-2-yl]methyl]ethanamine |
| SMILES | FC(F)n1ccnc1CNCCC1CCC1 |
| InChI | InChI=1S/C11H17F2N3/c12-11(13)16-7-6-15-10(16)8-14-5-4-9-2-1-3-9/h6-7,9,11,14H,1-5,8H2 |
| InChIKey | WTTPRAWOGIVEOP-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.27 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|