C10H15F2N3O — CID 66006553
3-[[[1-(difluoromethyl)imidazol-2-yl]methylamino]methyl]cyclobutan-1-ol (PubChem CID 66006553) has the molecular formula C10H15F2N3O and a molecular weight of 231.25 g/mol. Its IUPAC name is 3-[[[1-(difluoromethyl)imidazol-2-yl]methylamino]methyl]cyclobutan-1-ol.
| Compound Name | 3-[[[1-(difluoromethyl)imidazol-2-yl]methylamino]methyl]cyclobutan-1-ol |
|---|---|
| PubChem CID | 66006553 |
| Molecular Formula | C10H15F2N3O |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.12 |
| IUPAC Name | 3-[[[1-(difluoromethyl)imidazol-2-yl]methylamino]methyl]cyclobutan-1-ol |
| SMILES | OC1CC(CNCc2nccn2C(F)F)C1 |
| InChI | InChI=1S/C10H15F2N3O/c11-10(12)15-2-1-14-9(15)6-13-5-7-3-8(16)4-7/h1-2,7-8,10,13,16H,3-6H2 |
| InChIKey | SKJXMJFYYKCQKJ-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |