C9H15F2N3O — CID 43416447
2-[[1-(difluoromethyl)imidazol-2-yl]methylamino]butan-1-ol (PubChem CID 43416447) has the molecular formula C9H15F2N3O and a molecular weight of 219.23 g/mol. Its IUPAC name is 2-[[1-(difluoromethyl)imidazol-2-yl]methylamino]butan-1-ol.
| Compound Name | 2-[[1-(difluoromethyl)imidazol-2-yl]methylamino]butan-1-ol |
|---|---|
| PubChem CID | 43416447 |
| Molecular Formula | C9H15F2N3O |
| Molecular Weight | 219.23 g/mol |
| Exact Mass | 219.12 |
| IUPAC Name | 2-[[1-(difluoromethyl)imidazol-2-yl]methylamino]butan-1-ol |
| SMILES | CCC(CO)NCc1nccn1C(F)F |
| InChI | InChI=1S/C9H15F2N3O/c1-2-7(6-15)13-5-8-12-3-4-14(8)9(10)11/h3-4,7,9,13,15H,2,5-6H2,1H3 |
| InChIKey | BPTTXYDKCDMYEE-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.23 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |