C11H13F2N3S — CID 81408360
(1S)-N-[[1-(difluoromethyl)imidazol-2-yl]methyl]-1-thiophen-2-ylethanamine (PubChem CID 81408360) has the molecular formula C11H13F2N3S and a molecular weight of 257.31 g/mol. Its IUPAC name is (1S)-N-[[1-(difluoromethyl)imidazol-2-yl]methyl]-1-thiophen-2-ylethanamine.
| Compound Name | (1S)-N-[[1-(difluoromethyl)imidazol-2-yl]methyl]-1-thiophen-2-ylethanamine |
|---|---|
| PubChem CID | 81408360 |
| Molecular Formula | C11H13F2N3S |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | (1S)-N-[[1-(difluoromethyl)imidazol-2-yl]methyl]-1-thiophen-2-ylethanamine |
| SMILES | C[C@H](NCc1nccn1C(F)F)c1cccs1 |
| InChI | InChI=1S/C11H13F2N3S/c1-8(9-3-2-6-17-9)15-7-10-14-4-5-16(10)11(12)13/h2-6,8,11,15H,7H2,1H3/t8-/m0/s1 |
| InChIKey | ZHWZCCHKYNTEAI-QMMMGPOBSA-N |
| XLogP | 3.19 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |