C18H20FN3S — CID 97224144
(1S)-1-(4-fluorophenyl)-N-[(1-propan-2-ylimidazol-2-yl)methyl]-1-thiophen-2-ylmethanamine (PubChem CID 97224144) has the molecular formula C18H20FN3S and a molecular weight of 329.44 g/mol. Its IUPAC name is (1S)-1-(4-fluorophenyl)-N-[(1-propan-2-ylimidazol-2-yl)methyl]-1-thiophen-2-ylmethanamine.
| Compound Name | (1S)-1-(4-fluorophenyl)-N-[(1-propan-2-ylimidazol-2-yl)methyl]-1-thiophen-2-ylmethanamine |
|---|---|
| PubChem CID | 97224144 |
| Molecular Formula | C18H20FN3S |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | (1S)-1-(4-fluorophenyl)-N-[(1-propan-2-ylimidazol-2-yl)methyl]-1-thiophen-2-ylmethanamine |
| SMILES | CC(C)n1ccnc1CN[C@@H](c1ccc(F)cc1)c1cccs1 |
| InChI | InChI=1S/C18H20FN3S/c1-13(2)22-10-9-20-17(22)12-21-18(16-4-3-11-23-16)14-5-7-15(19)8-6-14/h3-11,13,18,21H,12H2,1-2H3/t18-/m0/s1 |
| InChIKey | CDCIJCSDOOYMAP-SFHVURJKSA-N |
| XLogP | 4.54 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |