C13H15F2N3 — CID 43112046
N-[[1-(difluoromethyl)imidazol-2-yl]methyl]-2-ethylaniline (PubChem CID 43112046) has the molecular formula C13H15F2N3 and a molecular weight of 251.28 g/mol. Its IUPAC name is N-[[1-(difluoromethyl)imidazol-2-yl]methyl]-2-ethylaniline.
| Compound Name | N-[[1-(difluoromethyl)imidazol-2-yl]methyl]-2-ethylaniline |
|---|---|
| PubChem CID | 43112046 |
| Molecular Formula | C13H15F2N3 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | N-[[1-(difluoromethyl)imidazol-2-yl]methyl]-2-ethylaniline |
| SMILES | CCc1ccccc1NCc1nccn1C(F)F |
| InChI | InChI=1S/C13H15F2N3/c1-2-10-5-3-4-6-11(10)17-9-12-16-7-8-18(12)13(14)15/h3-8,13,17H,2,9H2,1H3 |
| InChIKey | SBZVUAQWFUYVRN-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |