C20H23N — CID 104716082
N-(1,3-diphenylpropan-2-yl)pent-4-yn-2-amine (PubChem CID 104716082) has the molecular formula C20H23N and a molecular weight of 277.41 g/mol. Its IUPAC name is N-(1,3-diphenylpropan-2-yl)pent-4-yn-2-amine.
| Compound Name | N-(1,3-diphenylpropan-2-yl)pent-4-yn-2-amine |
|---|---|
| PubChem CID | 104716082 |
| Molecular Formula | C20H23N |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | N-(1,3-diphenylpropan-2-yl)pent-4-yn-2-amine |
| SMILES | C#CCC(C)NC(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C20H23N/c1-3-10-17(2)21-20(15-18-11-6-4-7-12-18)16-19-13-8-5-9-14-19/h1,4-9,11-14,17,20-21H,10,15-16H2,2H3 |
| InChIKey | UKISUJLSMZAKSM-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|