C16H15N3O — CID 104716737
2-amino-3-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)benzonitrile (PubChem CID 104716737) has the molecular formula C16H15N3O and a molecular weight of 265.32 g/mol. Its IUPAC name is 2-amino-3-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)benzonitrile.
| Compound Name | 2-amino-3-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)benzonitrile |
|---|---|
| PubChem CID | 104716737 |
| Molecular Formula | C16H15N3O |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | 2-amino-3-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)benzonitrile |
| SMILES | N#Cc1cccc(N2CCOc3ccccc3C2)c1N |
| InChI | InChI=1S/C16H15N3O/c17-10-12-5-3-6-14(16(12)18)19-8-9-20-15-7-2-1-4-13(15)11-19/h1-7H,8-9,11,18H2 |
| InChIKey | RLXBBAOIKJSHHA-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 62.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|