C18H36O3Si — CID 10471737
ethyl (Z)-12-hydroxy-2-(trimethylsilylmethyl)dodec-2-enoate (PubChem CID 10471737) has the molecular formula C18H36O3Si and a molecular weight of 328.57 g/mol. Its IUPAC name is ethyl (Z)-12-hydroxy-2-(trimethylsilylmethyl)dodec-2-enoate.
| Compound Name | ethyl (Z)-12-hydroxy-2-(trimethylsilylmethyl)dodec-2-enoate |
|---|---|
| PubChem CID | 10471737 |
| Molecular Formula | C18H36O3Si |
| Molecular Weight | 328.57 g/mol |
| Exact Mass | 328.24 |
| IUPAC Name | ethyl (Z)-12-hydroxy-2-(trimethylsilylmethyl)dodec-2-enoate |
| SMILES | CCOC(=O)/C(=C/CCCCCCCCCO)C[Si](C)(C)C |
| InChI | InChI=1S/C18H36O3Si/c1-5-21-18(20)17(16-22(2,3)4)14-12-10-8-6-7-9-11-13-15-19/h14,19H,5-13,15-16H2,1-4H3/b17-14+ |
| InChIKey | UONPBJSLVAUZQT-SAPNQHFASA-N |
| XLogP | 4.93 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.57 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|