C11H10F3N3O3 — CID 104717890
2-nitro-3-[2-(2,2,2-trifluoroethoxy)ethylamino]benzonitrile (PubChem CID 104717890) has the molecular formula C11H10F3N3O3 and a molecular weight of 289.21 g/mol. Its IUPAC name is 2-nitro-3-[2-(2,2,2-trifluoroethoxy)ethylamino]benzonitrile.
| Compound Name | 2-nitro-3-[2-(2,2,2-trifluoroethoxy)ethylamino]benzonitrile |
|---|---|
| PubChem CID | 104717890 |
| Molecular Formula | C11H10F3N3O3 |
| Molecular Weight | 289.21 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | 2-nitro-3-[2-(2,2,2-trifluoroethoxy)ethylamino]benzonitrile |
| SMILES | N#Cc1cccc(NCCOCC(F)(F)F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C11H10F3N3O3/c12-11(13,14)7-20-5-4-16-9-3-1-2-8(6-15)10(9)17(18)19/h1-3,16H,4-5,7H2 |
| InChIKey | HNUCRNLCHJMHRJ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 88.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.21 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|