C16H29NO4S — CID 10471912
2-[4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-sulfanylpropyl]cyclohexyl]acetic acid (PubChem CID 10471912) has the molecular formula C16H29NO4S and a molecular weight of 331.48 g/mol. Its IUPAC name is 2-[4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-sulfanylpropyl]cyclohexyl]acetic acid.
| Compound Name | 2-[4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-sulfanylpropyl]cyclohexyl]acetic acid |
|---|---|
| PubChem CID | 10471912 |
| Molecular Formula | C16H29NO4S |
| Molecular Weight | 331.48 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | 2-[4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-sulfanylpropyl]cyclohexyl]acetic acid |
| SMILES | CC(C)(C)OC(=O)NC(CS)CC1CCC(CC(=O)O)CC1 |
| InChI | InChI=1S/C16H29NO4S/c1-16(2,3)21-15(20)17-13(10-22)8-11-4-6-12(7-5-11)9-14(18)19/h11-13,22H,4-10H2,1-3H3,(H,17,20)(H,18,19) |
| InChIKey | WCSVKMRQDNPMJS-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.48 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|