C15H27NO7 — CID 10472000
(1S,2S,3S,4R,6R)-4-[[(1R,3R,4S,5R,8R)-4-hydroxy-3-methoxy-6-oxabicyclo[3.2.1]octan-8-yl]amino]-6-(hydroxymethyl)cyclohexane-1,2,3-triol (PubChem CID 10472000) has the molecular formula C15H27NO7 and a molecular weight of 333.38 g/mol. Its IUPAC name is (1S,2S,3S,4R,6R)-4-[[(1R,3R,4S,5R,8R)-4-hydroxy-3-methoxy-6-oxabicyclo[3.2.1]octan-8-yl]amino]-6-(hydroxymethyl)cyclohexane-1,2,3-triol.
| Compound Name | (1S,2S,3S,4R,6R)-4-[[(1R,3R,4S,5R,8R)-4-hydroxy-3-methoxy-6-oxabicyclo[3.2.1]octan-8-yl]amino]-6-(hydroxymethyl)cyclohexane-1,2,3-triol |
|---|---|
| PubChem CID | 10472000 |
| Molecular Formula | C15H27NO7 |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.18 |
| IUPAC Name | (1S,2S,3S,4R,6R)-4-[[(1R,3R,4S,5R,8R)-4-hydroxy-3-methoxy-6-oxabicyclo[3.2.1]octan-8-yl]amino]-6-(hydroxymethyl)cyclohexane-1,2,3-triol |
| SMILES | CO[C@@H]1C[C@H]2CO[C@@H]([C@H]1O)[C@@H]2N[C@@H]1C[C@H](CO)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C15H27NO7/c1-22-9-3-7-5-23-15(13(9)20)10(7)16-8-2-6(4-17)11(18)14(21)12(8)19/h6-21H,2-5H2,1H3/t6-,7+,8-,9-,10-,11+,12+,13+,14+,15-/m1/s1 |
| InChIKey | CLMQCLQWLGHAKB-MVEHZGHSSA-N |
| XLogP | -2.80 |
| TPSA | 131.64 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | -2.80 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |