C13H27NO4 — CID 162476727
(1S,2R,3R,5R)-3-(hydroxymethyl)-5-[3-[(2-methylpropan-2-yl)oxy]propylamino]cyclopentane-1,2-diol (PubChem CID 162476727) has the molecular formula C13H27NO4 and a molecular weight of 261.36 g/mol. Its IUPAC name is (1S,2R,3R,5R)-3-(hydroxymethyl)-5-[3-[(2-methylpropan-2-yl)oxy]propylamino]cyclopentane-1,2-diol.
| Compound Name | (1S,2R,3R,5R)-3-(hydroxymethyl)-5-[3-[(2-methylpropan-2-yl)oxy]propylamino]cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 162476727 |
| Molecular Formula | C13H27NO4 |
| Molecular Weight | 261.36 g/mol |
| Exact Mass | 261.19 |
| IUPAC Name | (1S,2R,3R,5R)-3-(hydroxymethyl)-5-[3-[(2-methylpropan-2-yl)oxy]propylamino]cyclopentane-1,2-diol |
| SMILES | CC(C)(C)OCCCN[C@@H]1C[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C13H27NO4/c1-13(2,3)18-6-4-5-14-10-7-9(8-15)11(16)12(10)17/h9-12,14-17H,4-8H2,1-3H3/t9-,10-,11-,12+/m1/s1 |
| InChIKey | FGNZSHITLGUCGX-KKOKHZNYSA-N |
| XLogP | -0.12 |
| TPSA | 81.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.36 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|