C10H10F3N3 — CID 104721226
[2-(2,2,2-trifluoroethyl)-1H-benzimidazol-4-yl]methanamine (PubChem CID 104721226) has the molecular formula C10H10F3N3 and a molecular weight of 229.20 g/mol. Its IUPAC name is [2-(2,2,2-trifluoroethyl)-1H-benzimidazol-4-yl]methanamine.
| Compound Name | [2-(2,2,2-trifluoroethyl)-1H-benzimidazol-4-yl]methanamine |
|---|---|
| PubChem CID | 104721226 |
| Molecular Formula | C10H10F3N3 |
| Molecular Weight | 229.20 g/mol |
| Exact Mass | 229.08 |
| IUPAC Name | [2-(2,2,2-trifluoroethyl)-1H-benzimidazol-4-yl]methanamine |
| SMILES | NCc1cccc2[nH]c(CC(F)(F)F)nc12 |
| InChI | InChI=1S/C10H10F3N3/c11-10(12,13)4-8-15-7-3-1-2-6(5-14)9(7)16-8/h1-3H,4-5,14H2,(H,15,16) |
| InChIKey | XTMUKKJQFLLSEP-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.20 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |