C14H18BrClN4 — CID 104725463
N-[[1-(2-bromo-5-chloro-4-methylphenyl)triazol-4-yl]methyl]-2-methylpropan-2-amine (PubChem CID 104725463) has the molecular formula C14H18BrClN4 and a molecular weight of 357.68 g/mol. Its IUPAC name is N-[[1-(2-bromo-5-chloro-4-methylphenyl)triazol-4-yl]methyl]-2-methylpropan-2-amine.
| Compound Name | N-[[1-(2-bromo-5-chloro-4-methylphenyl)triazol-4-yl]methyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 104725463 |
| Molecular Formula | C14H18BrClN4 |
| Molecular Weight | 357.68 g/mol |
| Exact Mass | 356.04 |
| IUPAC Name | N-[[1-(2-bromo-5-chloro-4-methylphenyl)triazol-4-yl]methyl]-2-methylpropan-2-amine |
| SMILES | Cc1cc(Br)c(-n2cc(CNC(C)(C)C)nn2)cc1Cl |
| InChI | InChI=1S/C14H18BrClN4/c1-9-5-11(15)13(6-12(9)16)20-8-10(18-19-20)7-17-14(2,3)4/h5-6,8,17H,7H2,1-4H3 |
| InChIKey | OWUWVEWALUNGFE-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.68 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |