C13H22N6 — CID 107465069
N-[[1-(3-ethyl-1-methylpyrazol-4-yl)triazol-4-yl]methyl]-2-methylpropan-2-amine (PubChem CID 107465069) has the molecular formula C13H22N6 and a molecular weight of 262.36 g/mol. Its IUPAC name is N-[[1-(3-ethyl-1-methylpyrazol-4-yl)triazol-4-yl]methyl]-2-methylpropan-2-amine.
| Compound Name | N-[[1-(3-ethyl-1-methylpyrazol-4-yl)triazol-4-yl]methyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 107465069 |
| Molecular Formula | C13H22N6 |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | N-[[1-(3-ethyl-1-methylpyrazol-4-yl)triazol-4-yl]methyl]-2-methylpropan-2-amine |
| SMILES | CCc1nn(C)cc1-n1cc(CNC(C)(C)C)nn1 |
| InChI | InChI=1S/C13H22N6/c1-6-11-12(9-18(5)16-11)19-8-10(15-17-19)7-14-13(2,3)4/h8-9,14H,6-7H2,1-5H3 |
| InChIKey | HIOPPJJMCXRRPQ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 60.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |