C13H15BrClFN4 — CID 107617556
N-[[1-(2-bromo-6-chloro-4-fluorophenyl)triazol-4-yl]methyl]-2-methylpropan-2-amine (PubChem CID 107617556) has the molecular formula C13H15BrClFN4 and a molecular weight of 361.65 g/mol. Its IUPAC name is N-[[1-(2-bromo-6-chloro-4-fluorophenyl)triazol-4-yl]methyl]-2-methylpropan-2-amine.
| Compound Name | N-[[1-(2-bromo-6-chloro-4-fluorophenyl)triazol-4-yl]methyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 107617556 |
| Molecular Formula | C13H15BrClFN4 |
| Molecular Weight | 361.65 g/mol |
| Exact Mass | 360.02 |
| IUPAC Name | N-[[1-(2-bromo-6-chloro-4-fluorophenyl)triazol-4-yl]methyl]-2-methylpropan-2-amine |
| SMILES | CC(C)(C)NCc1cn(-c2c(Cl)cc(F)cc2Br)nn1 |
| InChI | InChI=1S/C13H15BrClFN4/c1-13(2,3)17-6-9-7-20(19-18-9)12-10(14)4-8(16)5-11(12)15/h4-5,7,17H,6H2,1-3H3 |
| InChIKey | HZFDVHWUWAFJPV-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.65 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |