C18H20FN3O3 — CID 10472731
3-[3,5-dimethyl-4-[3-(3-methyl-1,2-oxazol-5-yl)propoxy]phenyl]-5-(fluoromethyl)-1,2,4-oxadiazole (PubChem CID 10472731) has the molecular formula C18H20FN3O3 and a molecular weight of 345.37 g/mol. Its IUPAC name is 3-[3,5-dimethyl-4-[3-(3-methyl-1,2-oxazol-5-yl)propoxy]phenyl]-5-(fluoromethyl)-1,2,4-oxadiazole.
| Compound Name | 3-[3,5-dimethyl-4-[3-(3-methyl-1,2-oxazol-5-yl)propoxy]phenyl]-5-(fluoromethyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 10472731 |
| Molecular Formula | C18H20FN3O3 |
| Molecular Weight | 345.37 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | 3-[3,5-dimethyl-4-[3-(3-methyl-1,2-oxazol-5-yl)propoxy]phenyl]-5-(fluoromethyl)-1,2,4-oxadiazole |
| SMILES | Cc1cc(CCCOc2c(C)cc(-c3noc(CF)n3)cc2C)on1 |
| InChI | InChI=1S/C18H20FN3O3/c1-11-7-14(18-20-16(10-19)25-22-18)8-12(2)17(11)23-6-4-5-15-9-13(3)21-24-15/h7-9H,4-6,10H2,1-3H3 |
| InChIKey | OUXVMIIGJBLSQG-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 74.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.37 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|