C19H21N3O5 — CID 5273036
[3-[3,5-dimethyl-4-[3-(3-methyl-1,2-oxazol-5-yl)propoxy]phenyl]-1,2,4-oxadiazol-5-yl] acetate (PubChem CID 5273036) has the molecular formula C19H21N3O5 and a molecular weight of 371.39 g/mol. Its IUPAC name is [3-[3,5-dimethyl-4-[3-(3-methyl-1,2-oxazol-5-yl)propoxy]phenyl]-1,2,4-oxadiazol-5-yl] acetate.
| Compound Name | [3-[3,5-dimethyl-4-[3-(3-methyl-1,2-oxazol-5-yl)propoxy]phenyl]-1,2,4-oxadiazol-5-yl] acetate |
|---|---|
| PubChem CID | 5273036 |
| Molecular Formula | C19H21N3O5 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | [3-[3,5-dimethyl-4-[3-(3-methyl-1,2-oxazol-5-yl)propoxy]phenyl]-1,2,4-oxadiazol-5-yl] acetate |
| SMILES | CC(=O)Oc1nc(-c2cc(C)c(OCCCc3cc(C)no3)c(C)c2)no1 |
| InChI | InChI=1S/C19H21N3O5/c1-11-8-15(18-20-19(27-22-18)25-14(4)23)9-12(2)17(11)24-7-5-6-16-10-13(3)21-26-16/h8-10H,5-7H2,1-4H3 |
| InChIKey | DIDSFGWVMHHLGW-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 100.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|