C13H14Cl2N4 — CID 104728613
2-N-(2,5-dichloro-4-methylphenyl)-6-N-ethylpyrazine-2,6-diamine (PubChem CID 104728613) has the molecular formula C13H14Cl2N4 and a molecular weight of 297.19 g/mol. Its IUPAC name is 2-N-(2,5-dichloro-4-methylphenyl)-6-N-ethylpyrazine-2,6-diamine.
| Compound Name | 2-N-(2,5-dichloro-4-methylphenyl)-6-N-ethylpyrazine-2,6-diamine |
|---|---|
| PubChem CID | 104728613 |
| Molecular Formula | C13H14Cl2N4 |
| Molecular Weight | 297.19 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | 2-N-(2,5-dichloro-4-methylphenyl)-6-N-ethylpyrazine-2,6-diamine |
| SMILES | CCNc1cncc(Nc2cc(Cl)c(C)cc2Cl)n1 |
| InChI | InChI=1S/C13H14Cl2N4/c1-3-17-12-6-16-7-13(19-12)18-11-5-9(14)8(2)4-10(11)15/h4-7H,3H2,1-2H3,(H2,17,18,19) |
| InChIKey | VELMHNHMQCHHHU-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.19 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |