C18H22FN3O3 — CID 10472868
7-(3-amino-3-methylazetidin-1-yl)-1-tert-butyl-6-fluoro-4-oxoquinoline-3-carboxylic acid (PubChem CID 10472868) has the molecular formula C18H22FN3O3 and a molecular weight of 347.39 g/mol. Its IUPAC name is 7-(3-amino-3-methylazetidin-1-yl)-1-tert-butyl-6-fluoro-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 7-(3-amino-3-methylazetidin-1-yl)-1-tert-butyl-6-fluoro-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 10472868 |
| Molecular Formula | C18H22FN3O3 |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | 7-(3-amino-3-methylazetidin-1-yl)-1-tert-butyl-6-fluoro-4-oxoquinoline-3-carboxylic acid |
| SMILES | CC1(N)CN(c2cc3c(cc2F)c(=O)c(C(=O)O)cn3C(C)(C)C)C1 |
| InChI | InChI=1S/C18H22FN3O3/c1-17(2,3)22-7-11(16(24)25)15(23)10-5-12(19)14(6-13(10)22)21-8-18(4,20)9-21/h5-7H,8-9,20H2,1-4H3,(H,24,25) |
| InChIKey | IOARNEHBYKOHQO-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 88.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |