C24H26FN3O3 — CID 22160624
1-tert-butyl-6-fluoro-4-oxo-7-(2-phenylpiperazin-1-yl)quinoline-3-carboxylic acid (PubChem CID 22160624) has the molecular formula C24H26FN3O3 and a molecular weight of 423.49 g/mol. Its IUPAC name is 1-tert-butyl-6-fluoro-4-oxo-7-(2-phenylpiperazin-1-yl)quinoline-3-carboxylic acid.
| Compound Name | 1-tert-butyl-6-fluoro-4-oxo-7-(2-phenylpiperazin-1-yl)quinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 22160624 |
| Molecular Formula | C24H26FN3O3 |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | 1-tert-butyl-6-fluoro-4-oxo-7-(2-phenylpiperazin-1-yl)quinoline-3-carboxylic acid |
| SMILES | CC(C)(C)n1cc(C(=O)O)c(=O)c2cc(F)c(N3CCNCC3c3ccccc3)cc21 |
| InChI | InChI=1S/C24H26FN3O3/c1-24(2,3)28-14-17(23(30)31)22(29)16-11-18(25)20(12-19(16)28)27-10-9-26-13-21(27)15-7-5-4-6-8-15/h4-8,11-12,14,21,26H,9-10,13H2,1-3H3,(H,30,31) |
| InChIKey | RSMMVWLLVNVVBE-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 74.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |