C21H20FNO4 — CID 71588152
1-tert-butyl-6-fluoro-7-(4-methoxyphenyl)-4-oxoquinoline-3-carboxylic acid (PubChem CID 71588152) has the molecular formula C21H20FNO4 and a molecular weight of 369.39 g/mol. Its IUPAC name is 1-tert-butyl-6-fluoro-7-(4-methoxyphenyl)-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 1-tert-butyl-6-fluoro-7-(4-methoxyphenyl)-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 71588152 |
| Molecular Formula | C21H20FNO4 |
| Molecular Weight | 369.39 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | 1-tert-butyl-6-fluoro-7-(4-methoxyphenyl)-4-oxoquinoline-3-carboxylic acid |
| SMILES | COc1ccc(-c2cc3c(cc2F)c(=O)c(C(=O)O)cn3C(C)(C)C)cc1 |
| InChI | InChI=1S/C21H20FNO4/c1-21(2,3)23-11-16(20(25)26)19(24)15-9-17(22)14(10-18(15)23)12-5-7-13(27-4)8-6-12/h5-11H,1-4H3,(H,25,26) |
| InChIKey | IXBCRHWFMHZFAA-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.39 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |