C10H9ClF3N3O2S — CID 104732302
4-(1-chloropropan-2-ylsulfonyl)-2-(trifluoromethyl)pyrazolo[1,5-a]pyrazine (PubChem CID 104732302) has the molecular formula C10H9ClF3N3O2S and a molecular weight of 327.72 g/mol. Its IUPAC name is 4-(1-chloropropan-2-ylsulfonyl)-2-(trifluoromethyl)pyrazolo[1,5-a]pyrazine.
| Compound Name | 4-(1-chloropropan-2-ylsulfonyl)-2-(trifluoromethyl)pyrazolo[1,5-a]pyrazine |
|---|---|
| PubChem CID | 104732302 |
| Molecular Formula | C10H9ClF3N3O2S |
| Molecular Weight | 327.72 g/mol |
| Exact Mass | 327.01 |
| IUPAC Name | 4-(1-chloropropan-2-ylsulfonyl)-2-(trifluoromethyl)pyrazolo[1,5-a]pyrazine |
| SMILES | CC(CCl)S(=O)(=O)c1nccn2nc(C(F)(F)F)cc12 |
| InChI | InChI=1S/C10H9ClF3N3O2S/c1-6(5-11)20(18,19)9-7-4-8(10(12,13)14)16-17(7)3-2-15-9/h2-4,6H,5H2,1H3 |
| InChIKey | PANULQAGNSZCPW-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 64.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.72 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|