C11H11ClF3N3O2S — CID 104732292
4-(4-chlorobutan-2-ylsulfonyl)-2-(trifluoromethyl)pyrazolo[1,5-a]pyrazine (PubChem CID 104732292) has the molecular formula C11H11ClF3N3O2S and a molecular weight of 341.74 g/mol. Its IUPAC name is 4-(4-chlorobutan-2-ylsulfonyl)-2-(trifluoromethyl)pyrazolo[1,5-a]pyrazine.
| Compound Name | 4-(4-chlorobutan-2-ylsulfonyl)-2-(trifluoromethyl)pyrazolo[1,5-a]pyrazine |
|---|---|
| PubChem CID | 104732292 |
| Molecular Formula | C11H11ClF3N3O2S |
| Molecular Weight | 341.74 g/mol |
| Exact Mass | 341.02 |
| IUPAC Name | 4-(4-chlorobutan-2-ylsulfonyl)-2-(trifluoromethyl)pyrazolo[1,5-a]pyrazine |
| SMILES | CC(CCCl)S(=O)(=O)c1nccn2nc(C(F)(F)F)cc12 |
| InChI | InChI=1S/C11H11ClF3N3O2S/c1-7(2-3-12)21(19,20)10-8-6-9(11(13,14)15)17-18(8)5-4-16-10/h4-7H,2-3H2,1H3 |
| InChIKey | KPXOHKLJNPATCF-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 64.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.74 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|