C11H12ClF3N4 — CID 113446611
N-(2-chloroethyl)-N-ethyl-2-(trifluoromethyl)pyrazolo[1,5-a]pyrazin-4-amine (PubChem CID 113446611) has the molecular formula C11H12ClF3N4 and a molecular weight of 292.69 g/mol. Its IUPAC name is N-(2-chloroethyl)-N-ethyl-2-(trifluoromethyl)pyrazolo[1,5-a]pyrazin-4-amine.
| Compound Name | N-(2-chloroethyl)-N-ethyl-2-(trifluoromethyl)pyrazolo[1,5-a]pyrazin-4-amine |
|---|---|
| PubChem CID | 113446611 |
| Molecular Formula | C11H12ClF3N4 |
| Molecular Weight | 292.69 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | N-(2-chloroethyl)-N-ethyl-2-(trifluoromethyl)pyrazolo[1,5-a]pyrazin-4-amine |
| SMILES | CCN(CCCl)c1nccn2nc(C(F)(F)F)cc12 |
| InChI | InChI=1S/C11H12ClF3N4/c1-2-18(5-3-12)10-8-7-9(11(13,14)15)17-19(8)6-4-16-10/h4,6-7H,2-3,5H2,1H3 |
| InChIKey | OWDXTZWQNGLJBK-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 33.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.69 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|