C17H11BrO4 — CID 10473610
2-[2-(4-bromophenyl)-2-oxoethyl]-2-hydroxyindene-1,3-dione (PubChem CID 10473610) has the molecular formula C17H11BrO4 and a molecular weight of 359.18 g/mol. Its IUPAC name is 2-[2-(4-bromophenyl)-2-oxoethyl]-2-hydroxyindene-1,3-dione.
| Compound Name | 2-[2-(4-bromophenyl)-2-oxoethyl]-2-hydroxyindene-1,3-dione |
|---|---|
| PubChem CID | 10473610 |
| Molecular Formula | C17H11BrO4 |
| Molecular Weight | 359.18 g/mol |
| Exact Mass | 357.98 |
| IUPAC Name | 2-[2-(4-bromophenyl)-2-oxoethyl]-2-hydroxyindene-1,3-dione |
| SMILES | O=C(CC1(O)C(=O)c2ccccc2C1=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C17H11BrO4/c18-11-7-5-10(6-8-11)14(19)9-17(22)15(20)12-3-1-2-4-13(12)16(17)21/h1-8,22H,9H2 |
| InChIKey | ZYJAABRWPTWKTM-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.18 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|