C18H10O6 — CID 21183
2-hydroxy-2-(2-hydroxy-1,3-dioxoinden-2-yl)indene-1,3-dione (PubChem CID 21183) has the molecular formula C18H10O6 and a molecular weight of 322.27 g/mol. Its IUPAC name is 2-hydroxy-2-(2-hydroxy-1,3-dioxoinden-2-yl)indene-1,3-dione.
| Compound Name | 2-hydroxy-2-(2-hydroxy-1,3-dioxoinden-2-yl)indene-1,3-dione |
|---|---|
| PubChem CID | 21183 |
| Molecular Formula | C18H10O6 |
| Molecular Weight | 322.27 g/mol |
| Exact Mass | 322.05 |
| IUPAC Name | 2-hydroxy-2-(2-hydroxy-1,3-dioxoinden-2-yl)indene-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)C1(O)C1(O)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C18H10O6/c19-13-9-5-1-2-6-10(9)14(20)17(13,23)18(24)15(21)11-7-3-4-8-12(11)16(18)22/h1-8,23-24H |
| InChIKey | LWFPYLZOVOCBPZ-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.27 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|