C18H14ClNO5 — CID 10473649
4-(7-benzoyl-5-chloro-2-oxo-1,3-benzoxazol-3-yl)butanoic acid (PubChem CID 10473649) has the molecular formula C18H14ClNO5 and a molecular weight of 359.77 g/mol. Its IUPAC name is 4-(7-benzoyl-5-chloro-2-oxo-1,3-benzoxazol-3-yl)butanoic acid.
| Compound Name | 4-(7-benzoyl-5-chloro-2-oxo-1,3-benzoxazol-3-yl)butanoic acid |
|---|---|
| PubChem CID | 10473649 |
| Molecular Formula | C18H14ClNO5 |
| Molecular Weight | 359.77 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | 4-(7-benzoyl-5-chloro-2-oxo-1,3-benzoxazol-3-yl)butanoic acid |
| SMILES | O=C(O)CCCn1c(=O)oc2c(C(=O)c3ccccc3)cc(Cl)cc21 |
| InChI | InChI=1S/C18H14ClNO5/c19-12-9-13(16(23)11-5-2-1-3-6-11)17-14(10-12)20(18(24)25-17)8-4-7-15(21)22/h1-3,5-6,9-10H,4,7-8H2,(H,21,22) |
| InChIKey | NNBDERRXBZNZET-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 89.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.77 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |