C15H16N2O — CID 104736728
1-(2,3-dihydro-1-benzofuran-3-yl)-2-pyridin-3-ylethanamine (PubChem CID 104736728) has the molecular formula C15H16N2O and a molecular weight of 240.31 g/mol. Its IUPAC name is 1-(2,3-dihydro-1-benzofuran-3-yl)-2-pyridin-3-ylethanamine.
| Compound Name | 1-(2,3-dihydro-1-benzofuran-3-yl)-2-pyridin-3-ylethanamine |
|---|---|
| PubChem CID | 104736728 |
| Molecular Formula | C15H16N2O |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | 1-(2,3-dihydro-1-benzofuran-3-yl)-2-pyridin-3-ylethanamine |
| SMILES | NC(Cc1cccnc1)C1COc2ccccc21 |
| InChI | InChI=1S/C15H16N2O/c16-14(8-11-4-3-7-17-9-11)13-10-18-15-6-2-1-5-12(13)15/h1-7,9,13-14H,8,10,16H2 |
| InChIKey | BGBJPFLTYBTXKR-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |