C16H19N3O — CID 65412028
3-[2-amino-2-(3,4-dihydro-2H-chromen-4-yl)ethyl]pyridin-4-amine (PubChem CID 65412028) has the molecular formula C16H19N3O and a molecular weight of 269.35 g/mol. Its IUPAC name is 3-[2-amino-2-(3,4-dihydro-2H-chromen-4-yl)ethyl]pyridin-4-amine.
| Compound Name | 3-[2-amino-2-(3,4-dihydro-2H-chromen-4-yl)ethyl]pyridin-4-amine |
|---|---|
| PubChem CID | 65412028 |
| Molecular Formula | C16H19N3O |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | 3-[2-amino-2-(3,4-dihydro-2H-chromen-4-yl)ethyl]pyridin-4-amine |
| SMILES | Nc1ccncc1CC(N)C1CCOc2ccccc21 |
| InChI | InChI=1S/C16H19N3O/c17-14-5-7-19-10-11(14)9-15(18)12-6-8-20-16-4-2-1-3-13(12)16/h1-5,7,10,12,15H,6,8-9,18H2,(H2,17,19) |
| InChIKey | MFUZUELQNIOKLG-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |