C11H13FN4 — CID 104738299
1-(3-fluoro-4-pyridinyl)-N-methyl-1-(1-methylpyrazol-3-yl)methanamine (PubChem CID 104738299) has the molecular formula C11H13FN4 and a molecular weight of 220.25 g/mol. Its IUPAC name is 1-(3-fluoro-4-pyridinyl)-N-methyl-1-(1-methylpyrazol-3-yl)methanamine.
| Compound Name | 1-(3-fluoro-4-pyridinyl)-N-methyl-1-(1-methylpyrazol-3-yl)methanamine |
|---|---|
| PubChem CID | 104738299 |
| Molecular Formula | C11H13FN4 |
| Molecular Weight | 220.25 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | 1-(3-fluoro-4-pyridinyl)-N-methyl-1-(1-methylpyrazol-3-yl)methanamine |
| SMILES | CNC(c1ccn(C)n1)c1ccncc1F |
| InChI | InChI=1S/C11H13FN4/c1-13-11(10-4-6-16(2)15-10)8-3-5-14-7-9(8)12/h3-7,11,13H,1-2H3 |
| InChIKey | CCIVOCVAIWCOFA-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.25 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |