C12H13FN4 — CID 104738640
1-(3-fluoro-4-pyridinyl)-N-methyl-1-(2-methylpyrimidin-4-yl)methanamine (PubChem CID 104738640) has the molecular formula C12H13FN4 and a molecular weight of 232.26 g/mol. Its IUPAC name is 1-(3-fluoro-4-pyridinyl)-N-methyl-1-(2-methylpyrimidin-4-yl)methanamine.
| Compound Name | 1-(3-fluoro-4-pyridinyl)-N-methyl-1-(2-methylpyrimidin-4-yl)methanamine |
|---|---|
| PubChem CID | 104738640 |
| Molecular Formula | C12H13FN4 |
| Molecular Weight | 232.26 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | 1-(3-fluoro-4-pyridinyl)-N-methyl-1-(2-methylpyrimidin-4-yl)methanamine |
| SMILES | CNC(c1ccnc(C)n1)c1ccncc1F |
| InChI | InChI=1S/C12H13FN4/c1-8-16-6-4-11(17-8)12(14-2)9-3-5-15-7-10(9)13/h3-7,12,14H,1-2H3 |
| InChIKey | KBHHJSYZFFJYBU-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.26 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |